C22H26O8 — CID 11270047
5-[4,5-bis(methoxymethoxy)-2-methylphenyl]-7-methoxy-2,2-dimethyl-1,3-benzodioxin-4-one (PubChem CID 11270047) has the molecular formula C22H26O8 and a molecular weight of 418.44 g/mol. Its IUPAC name is 5-[4,5-bis(methoxymethoxy)-2-methylphenyl]-7-methoxy-2,2-dimethyl-1,3-benzodioxin-4-one.
| Compound Name | 5-[4,5-bis(methoxymethoxy)-2-methylphenyl]-7-methoxy-2,2-dimethyl-1,3-benzodioxin-4-one |
|---|---|
| PubChem CID | 11270047 |
| Molecular Formula | C22H26O8 |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 5-[4,5-bis(methoxymethoxy)-2-methylphenyl]-7-methoxy-2,2-dimethyl-1,3-benzodioxin-4-one |
| SMILES | COCOc1cc(C)c(-c2cc(OC)cc3c2C(=O)OC(C)(C)O3)cc1OCOC |
| InChI | InChI=1S/C22H26O8/c1-13-7-17(27-11-24-4)18(28-12-25-5)10-15(13)16-8-14(26-6)9-19-20(16)21(23)30-22(2,3)29-19/h7-10H,11-12H2,1-6H3 |
| InChIKey | ZVFLZXTVKHFJIJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|