C17H22O5 — CID 11150905
7-(2-hydroxyethoxy)-2,2-dimethyl-5-(3-methylbut-2-enyl)-1,3-benzodioxin-4-one (PubChem CID 11150905) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is 7-(2-hydroxyethoxy)-2,2-dimethyl-5-(3-methylbut-2-enyl)-1,3-benzodioxin-4-one.
| Compound Name | 7-(2-hydroxyethoxy)-2,2-dimethyl-5-(3-methylbut-2-enyl)-1,3-benzodioxin-4-one |
|---|---|
| PubChem CID | 11150905 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 7-(2-hydroxyethoxy)-2,2-dimethyl-5-(3-methylbut-2-enyl)-1,3-benzodioxin-4-one |
| SMILES | CC(C)=CCc1cc(OCCO)cc2c1C(=O)OC(C)(C)O2 |
| InChI | InChI=1S/C17H22O5/c1-11(2)5-6-12-9-13(20-8-7-18)10-14-15(12)16(19)22-17(3,4)21-14/h5,9-10,18H,6-8H2,1-4H3 |
| InChIKey | KEXOWKMEGDPKID-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|