C20H24O8 — CID 72702488
7-methoxy-5-[2-[2-(methoxymethoxy)ethyl]-2-methyl-5-oxofuran-3-yl]-2,2-dimethyl-1,3-benzodioxin-4-one (PubChem CID 72702488) has the molecular formula C20H24O8 and a molecular weight of 392.40 g/mol. Its IUPAC name is 7-methoxy-5-[2-[2-(methoxymethoxy)ethyl]-2-methyl-5-oxofuran-3-yl]-2,2-dimethyl-1,3-benzodioxin-4-one.
| Compound Name | 7-methoxy-5-[2-[2-(methoxymethoxy)ethyl]-2-methyl-5-oxofuran-3-yl]-2,2-dimethyl-1,3-benzodioxin-4-one |
|---|---|
| PubChem CID | 72702488 |
| Molecular Formula | C20H24O8 |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 7-methoxy-5-[2-[2-(methoxymethoxy)ethyl]-2-methyl-5-oxofuran-3-yl]-2,2-dimethyl-1,3-benzodioxin-4-one |
| SMILES | COCOCCC1(C)OC(=O)C=C1c1cc(OC)cc2c1C(=O)OC(C)(C)O2 |
| InChI | InChI=1S/C20H24O8/c1-19(2)26-15-9-12(24-5)8-13(17(15)18(22)28-19)14-10-16(21)27-20(14,3)6-7-25-11-23-4/h8-10H,6-7,11H2,1-5H3 |
| InChIKey | OXXPPDBXKUJKIL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|