C27H50O7 — CID 59904345
2-(4-hydroxy-3,5,7,9,11,13-hexamethylpentadeca-1,5-dien-8-yl)oxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 59904345) has the molecular formula C27H50O7 and a molecular weight of 486.69 g/mol. Its IUPAC name is 2-(4-hydroxy-3,5,7,9,11,13-hexamethylpentadeca-1,5-dien-8-yl)oxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-(4-hydroxy-3,5,7,9,11,13-hexamethylpentadeca-1,5-dien-8-yl)oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 59904345 |
| Molecular Formula | C27H50O7 |
| Molecular Weight | 486.69 g/mol |
| Exact Mass | 486.36 |
| IUPAC Name | 2-(4-hydroxy-3,5,7,9,11,13-hexamethylpentadeca-1,5-dien-8-yl)oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | C=CC(C)C(O)C(C)=CC(C)C(OC1OC(CO)C(O)C(O)C1O)C(C)CC(C)CC(C)CC |
| InChI | InChI=1S/C27H50O7/c1-9-15(3)11-16(4)12-19(7)26(20(8)13-18(6)22(29)17(5)10-2)34-27-25(32)24(31)23(30)21(14-28)33-27/h10,13,15-17,19-32H,2,9,11-12,14H2,1,3-8H3 |
| InChIKey | STKCRVLEEBTQCV-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.69 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|