C26H25N3O7 — CID 59907460
methyl (2E)-2-[2-[[3-(3-cyano-4-nitrophenoxy)phenoxy]methyl]-4,5-dimethylcyclohexa-1,4-dien-1-yl]-2-methoxyiminoacetate (PubChem CID 59907460) has the molecular formula C26H25N3O7 and a molecular weight of 491.50 g/mol. Its IUPAC name is methyl (2E)-2-[2-[[3-(3-cyano-4-nitrophenoxy)phenoxy]methyl]-4,5-dimethylcyclohexa-1,4-dien-1-yl]-2-methoxyiminoacetate.
| Compound Name | methyl (2E)-2-[2-[[3-(3-cyano-4-nitrophenoxy)phenoxy]methyl]-4,5-dimethylcyclohexa-1,4-dien-1-yl]-2-methoxyiminoacetate |
|---|---|
| PubChem CID | 59907460 |
| Molecular Formula | C26H25N3O7 |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | methyl (2E)-2-[2-[[3-(3-cyano-4-nitrophenoxy)phenoxy]methyl]-4,5-dimethylcyclohexa-1,4-dien-1-yl]-2-methoxyiminoacetate |
| SMILES | CO/N=C(/C(=O)OC)C1=C(COc2cccc(Oc3ccc([N+](=O)[O-])c(C#N)c3)c2)CC(C)=C(C)C1 |
| InChI | InChI=1S/C26H25N3O7/c1-16-10-19(23(11-17(16)2)25(28-34-4)26(30)33-3)15-35-20-6-5-7-21(13-20)36-22-8-9-24(29(31)32)18(12-22)14-27/h5-9,12-13H,10-11,15H2,1-4H3/b28-25+ |
| InChIKey | KPGWLBOVZRMMBP-AZPGRJICSA-N |
| XLogP | 5.24 |
| TPSA | 133.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|