C7H5Cl2Y- — CID 59907881
2,4-dichloro-1-methylbenzene-3-ide;yttrium (PubChem CID 59907881) has the molecular formula C7H5Cl2Y- and a molecular weight of 248.93 g/mol. Its IUPAC name is 2,4-dichloro-1-methylbenzene-3-ide;yttrium.
| Compound Name | 2,4-dichloro-1-methylbenzene-3-ide;yttrium |
|---|---|
| PubChem CID | 59907881 |
| Molecular Formula | C7H5Cl2Y- |
| Molecular Weight | 248.93 g/mol |
| Exact Mass | 247.88 |
| IUPAC Name | 2,4-dichloro-1-methylbenzene-3-ide;yttrium |
| SMILES | Cc1ccc(Cl)[c-]c1Cl.[Y] |
| InChI | InChI=1S/C7H5Cl2.Y/c1-5-2-3-6(8)4-7(5)9;/h2-3H,1H3;/q-1; |
| InChIKey | BMNDVVAQRAOVRN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.93 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|