About 3-chloro-4-methylbenzene-2-id-1-ol;tungsten
3-chloro-4-methylbenzene-2-id-1-ol;tungsten (PubChem CID 156723461) has the molecular formula C7H6ClOW-
and a molecular weight of 325.42 g/mol. Its IUPAC name is 3-chloro-4-methylbenzene-2-id-1-ol;tungsten.
Molecular Properties
| Compound Name | 3-chloro-4-methylbenzene-2-id-1-ol;tungsten |
| PubChem CID | 156723461 |
| Molecular Formula | C7H6ClOW- |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 324.96 |
| IUPAC Name | 3-chloro-4-methylbenzene-2-id-1-ol;tungsten |
| SMILES | Cc1ccc(O)[c-]c1Cl.[W] |
| InChI | InChI=1S/C7H6ClO.W/c1-5-2-3-6(9)4-7(5)8;/h2-3,9H,1H3;/q-1; |
| InChIKey | FNKRVDTYYSKCTM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-4-methylbenzene-2-id-1-ol;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-methylbenzene-2-id-1-ol;tungsten?
The IUPAC name of 3-chloro-4-methylbenzene-2-id-1-ol;tungsten (CID 156723461) is 3-chloro-4-methylbenzene-2-id-1-ol;tungsten.
What is the SMILES notation for 3-chloro-4-methylbenzene-2-id-1-ol;tungsten?
The canonical SMILES for 3-chloro-4-methylbenzene-2-id-1-ol;tungsten is Cc1ccc(O)[c-]c1Cl.[W].
What is the InChIKey of 3-chloro-4-methylbenzene-2-id-1-ol;tungsten?
The InChIKey is FNKRVDTYYSKCTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClO.W/c1-5-2-3-6(9)4-7(5)8;/h2-3,9H,1H3;/q-1;.
What are the key properties of 3-chloro-4-methylbenzene-2-id-1-ol;tungsten?
3-chloro-4-methylbenzene-2-id-1-ol;tungsten has a molecular weight of 325.42 g/mol, XLogP of 2.15, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-methylbenzene-2-id-1-ol;tungsten is sourced from PubChem (CID 156723461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).