About dimethylphosphoryl(fluoro)methanesulfinate;rhenium
dimethylphosphoryl(fluoro)methanesulfinate;rhenium (PubChem CID 59908256) has the molecular formula C3H7FO3PReS-
and a molecular weight of 359.33 g/mol. Its IUPAC name is dimethylphosphoryl(fluoro)methanesulfinate;rhenium.
Molecular Properties
| Compound Name | dimethylphosphoryl(fluoro)methanesulfinate;rhenium |
| PubChem CID | 59908256 |
| Molecular Formula | C3H7FO3PReS- |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 359.94 |
| IUPAC Name | dimethylphosphoryl(fluoro)methanesulfinate;rhenium |
| SMILES | CP(C)(=O)C(F)S(=O)[O-].[Re] |
| InChI | InChI=1S/C3H8FO3PS.Re/c1-8(2,5)3(4)9(6)7;/h3H,1-2H3,(H,6,7);/p-1 |
| InChIKey | MIABGNNUDKEWBO-UHFFFAOYSA-M |
| XLogP | 0.74 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze dimethylphosphoryl(fluoro)methanesulfinate;rhenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylphosphoryl(fluoro)methanesulfinate;rhenium?
The IUPAC name of dimethylphosphoryl(fluoro)methanesulfinate;rhenium (CID 59908256) is dimethylphosphoryl(fluoro)methanesulfinate;rhenium.
What is the SMILES notation for dimethylphosphoryl(fluoro)methanesulfinate;rhenium?
The canonical SMILES for dimethylphosphoryl(fluoro)methanesulfinate;rhenium is CP(C)(=O)C(F)S(=O)[O-].[Re].
What is the InChIKey of dimethylphosphoryl(fluoro)methanesulfinate;rhenium?
The InChIKey is MIABGNNUDKEWBO-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H8FO3PS.Re/c1-8(2,5)3(4)9(6)7;/h3H,1-2H3,(H,6,7);/p-1.
What are the key properties of dimethylphosphoryl(fluoro)methanesulfinate;rhenium?
dimethylphosphoryl(fluoro)methanesulfinate;rhenium has a molecular weight of 359.33 g/mol, XLogP of 0.74, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylphosphoryl(fluoro)methanesulfinate;rhenium is sourced from PubChem (CID 59908256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).