About lithium;amino(fluoro)methanesulfinate;hydride
lithium;amino(fluoro)methanesulfinate;hydride (PubChem CID 174808925) has the molecular formula CH4FLiNO2S-
and a molecular weight of 120.05 g/mol. Its IUPAC name is lithium;amino(fluoro)methanesulfinate;hydride.
Molecular Properties
| Compound Name | lithium;amino(fluoro)methanesulfinate;hydride |
| PubChem CID | 174808925 |
| Molecular Formula | CH4FLiNO2S- |
| Molecular Weight | 120.05 g/mol |
| Exact Mass | 120.01 |
| IUPAC Name | lithium;amino(fluoro)methanesulfinate;hydride |
| SMILES | NC(F)S(=O)[O-].[H-].[Li+] |
| InChI | InChI=1S/CH4FNO2S.Li.H/c2-1(3)6(4)5;;/h1H,3H2,(H,4,5);;/q;+1;-1/p-1 |
| InChIKey | KVXQUPLYXCWDST-UHFFFAOYSA-M |
| XLogP | -3.81 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.05 |
| LogP ≤ 5 | -3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze lithium;amino(fluoro)methanesulfinate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;amino(fluoro)methanesulfinate;hydride?
The IUPAC name of lithium;amino(fluoro)methanesulfinate;hydride (CID 174808925) is lithium;amino(fluoro)methanesulfinate;hydride.
What is the SMILES notation for lithium;amino(fluoro)methanesulfinate;hydride?
The canonical SMILES for lithium;amino(fluoro)methanesulfinate;hydride is NC(F)S(=O)[O-].[H-].[Li+].
What is the InChIKey of lithium;amino(fluoro)methanesulfinate;hydride?
The InChIKey is KVXQUPLYXCWDST-UHFFFAOYSA-M. The full InChI is InChI=1S/CH4FNO2S.Li.H/c2-1(3)6(4)5;;/h1H,3H2,(H,4,5);;/q;+1;-1/p-1.
What are the key properties of lithium;amino(fluoro)methanesulfinate;hydride?
lithium;amino(fluoro)methanesulfinate;hydride has a molecular weight of 120.05 g/mol, XLogP of -3.81, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;amino(fluoro)methanesulfinate;hydride is sourced from PubChem (CID 174808925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).