C3H3F4O2S- — CID 91562788
1,1,3,3-tetrafluoropropane-2-sulfinate (PubChem CID 91562788) has the molecular formula C3H3F4O2S- and a molecular weight of 179.11 g/mol. Its IUPAC name is 1,1,3,3-tetrafluoropropane-2-sulfinate.
| Compound Name | 1,1,3,3-tetrafluoropropane-2-sulfinate |
|---|---|
| PubChem CID | 91562788 |
| Molecular Formula | C3H3F4O2S- |
| Molecular Weight | 179.11 g/mol |
| Exact Mass | 178.98 |
| IUPAC Name | 1,1,3,3-tetrafluoropropane-2-sulfinate |
| SMILES | O=S([O-])C(C(F)F)C(F)F |
| InChI | InChI=1S/C3H4F4O2S/c4-2(5)1(3(6)7)10(8)9/h1-3H,(H,8,9)/p-1 |
| InChIKey | PSRMMVFMKVEGAN-UHFFFAOYSA-M |
| XLogP | 0.76 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.11 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|