C12H21N3O3 — CID 59908801
(Z,2S)-2-amino-6-[(2R)-7-(hydroxyamino)-3,4,5,6-tetrahydro-2H-azepin-2-yl]hex-4-enoic acid (PubChem CID 59908801) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is (Z,2S)-2-amino-6-[(2R)-7-(hydroxyamino)-3,4,5,6-tetrahydro-2H-azepin-2-yl]hex-4-enoic acid.
| Compound Name | (Z,2S)-2-amino-6-[(2R)-7-(hydroxyamino)-3,4,5,6-tetrahydro-2H-azepin-2-yl]hex-4-enoic acid |
|---|---|
| PubChem CID | 59908801 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | (Z,2S)-2-amino-6-[(2R)-7-(hydroxyamino)-3,4,5,6-tetrahydro-2H-azepin-2-yl]hex-4-enoic acid |
| SMILES | N[C@@H](C/C=C\C[C@H]1CCCCC(NO)=N1)C(=O)O |
| InChI | InChI=1S/C12H21N3O3/c13-10(12(16)17)7-3-1-5-9-6-2-4-8-11(14-9)15-18/h1,3,9-10,18H,2,4-8,13H2,(H,14,15)(H,16,17)/b3-1-/t9-,10-/m0/s1 |
| InChIKey | ZVMYUXSHMRXMKY-CVLTWBRKSA-N |
| XLogP | 1.05 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|