C17H17Cl2NO — CID 59909218
N-[(2,6-dichlorophenyl)methoxy]-1-(3-ethylphenyl)ethanimine (PubChem CID 59909218) has the molecular formula C17H17Cl2NO and a molecular weight of 322.24 g/mol. Its IUPAC name is N-[(2,6-dichlorophenyl)methoxy]-1-(3-ethylphenyl)ethanimine.
| Compound Name | N-[(2,6-dichlorophenyl)methoxy]-1-(3-ethylphenyl)ethanimine |
|---|---|
| PubChem CID | 59909218 |
| Molecular Formula | C17H17Cl2NO |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | N-[(2,6-dichlorophenyl)methoxy]-1-(3-ethylphenyl)ethanimine |
| SMILES | CCc1cccc(C(C)=NOCc2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C17H17Cl2NO/c1-3-13-6-4-7-14(10-13)12(2)20-21-11-15-16(18)8-5-9-17(15)19/h4-10H,3,11H2,1-2H3 |
| InChIKey | QKNSKYPAPSJQFL-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|