C15H21N7O6S — CID 59909589
(2S,3S,4R,5R)-5-[2-[(ethenylsulfonylamino)methyl]-6-(methylamino)purin-9-yl]-3,4-dihydroxy-N-methyloxolane-2-carboxamide (PubChem CID 59909589) has the molecular formula C15H21N7O6S and a molecular weight of 427.44 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[2-[(ethenylsulfonylamino)methyl]-6-(methylamino)purin-9-yl]-3,4-dihydroxy-N-methyloxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-[2-[(ethenylsulfonylamino)methyl]-6-(methylamino)purin-9-yl]-3,4-dihydroxy-N-methyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 59909589 |
| Molecular Formula | C15H21N7O6S |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | (2S,3S,4R,5R)-5-[2-[(ethenylsulfonylamino)methyl]-6-(methylamino)purin-9-yl]-3,4-dihydroxy-N-methyloxolane-2-carboxamide |
| SMILES | C=CS(=O)(=O)NCc1nc(NC)c2ncn([C@@H]3O[C@H](C(=O)NC)[C@@H](O)[C@H]3O)c2n1 |
| InChI | InChI=1S/C15H21N7O6S/c1-4-29(26,27)19-5-7-20-12(16-2)8-13(21-7)22(6-18-8)15-10(24)9(23)11(28-15)14(25)17-3/h4,6,9-11,15,19,23-24H,1,5H2,2-3H3,(H,17,25)(H,16,20,21)/t9-,10+,11-,15+/m0/s1 |
| InChIKey | UPYQJGGZWGJDBX-BQVMBELUSA-N |
| XLogP | -2.20 |
| TPSA | 180.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |