C22H29N7O6S — CID 59035922
(2S,3S,4R,5R)-5-[2-[[(3,4-dimethylphenyl)sulfonylamino]methyl]-6-(methylamino)purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide (PubChem CID 59035922) has the molecular formula C22H29N7O6S and a molecular weight of 519.58 g/mol. Its IUPAC name is (2S,3S,4R,5R)-5-[2-[[(3,4-dimethylphenyl)sulfonylamino]methyl]-6-(methylamino)purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide.
| Compound Name | (2S,3S,4R,5R)-5-[2-[[(3,4-dimethylphenyl)sulfonylamino]methyl]-6-(methylamino)purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
|---|---|
| PubChem CID | 59035922 |
| Molecular Formula | C22H29N7O6S |
| Molecular Weight | 519.58 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | (2S,3S,4R,5R)-5-[2-[[(3,4-dimethylphenyl)sulfonylamino]methyl]-6-(methylamino)purin-9-yl]-N-ethyl-3,4-dihydroxyoxolane-2-carboxamide |
| SMILES | CCNC(=O)[C@H]1O[C@@H](n2cnc3c(NC)nc(CNS(=O)(=O)c4ccc(C)c(C)c4)nc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H29N7O6S/c1-5-24-21(32)18-16(30)17(31)22(35-18)29-10-25-15-19(23-4)27-14(28-20(15)29)9-26-36(33,34)13-7-6-11(2)12(3)8-13/h6-8,10,16-18,22,26,30-31H,5,9H2,1-4H3,(H,24,32)(H,23,27,28)/t16-,17+,18-,22+/m0/s1 |
| InChIKey | NBZWJPVDOSOFQE-RQXXJAGISA-N |
| XLogP | -0.28 |
| TPSA | 180.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.58 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |