C13H24O2 — CID 59910094
2-[(Z)-2,5-dimethylhex-3-enoxy]oxane (PubChem CID 59910094) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is 2-[(Z)-2,5-dimethylhex-3-enoxy]oxane.
| Compound Name | 2-[(Z)-2,5-dimethylhex-3-enoxy]oxane |
|---|---|
| PubChem CID | 59910094 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 2-[(Z)-2,5-dimethylhex-3-enoxy]oxane |
| SMILES | CC(C)/C=C\C(C)COC1CCCCO1 |
| InChI | InChI=1S/C13H24O2/c1-11(2)7-8-12(3)10-15-13-6-4-5-9-14-13/h7-8,11-13H,4-6,9-10H2,1-3H3/b8-7- |
| InChIKey | BDWVHOCWEJFDJU-FPLPWBNLSA-N |
| XLogP | 3.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|