C30H24N2O6 — CID 59912788
2-N-[(3,4-dihydroxyphenyl)methyl]-7-N-[(3-hydroxy-4-methylphenyl)methyl]-9-oxofluorene-2,7-dicarboxamide (PubChem CID 59912788) has the molecular formula C30H24N2O6 and a molecular weight of 508.53 g/mol. Its IUPAC name is 2-N-[(3,4-dihydroxyphenyl)methyl]-7-N-[(3-hydroxy-4-methylphenyl)methyl]-9-oxofluorene-2,7-dicarboxamide.
| Compound Name | 2-N-[(3,4-dihydroxyphenyl)methyl]-7-N-[(3-hydroxy-4-methylphenyl)methyl]-9-oxofluorene-2,7-dicarboxamide |
|---|---|
| PubChem CID | 59912788 |
| Molecular Formula | C30H24N2O6 |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | 2-N-[(3,4-dihydroxyphenyl)methyl]-7-N-[(3-hydroxy-4-methylphenyl)methyl]-9-oxofluorene-2,7-dicarboxamide |
| SMILES | Cc1ccc(CNC(=O)c2ccc3c(c2)C(=O)c2cc(C(=O)NCc4ccc(O)c(O)c4)ccc2-3)cc1O |
| InChI | InChI=1S/C30H24N2O6/c1-16-2-3-17(10-26(16)34)14-31-29(37)19-5-7-21-22-8-6-20(13-24(22)28(36)23(21)12-19)30(38)32-15-18-4-9-25(33)27(35)11-18/h2-13,33-35H,14-15H2,1H3,(H,31,37)(H,32,38) |
| InChIKey | FBGJKJFNQMWGTL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|