C21H21N3O6 — CID 67598436
2-N,4-N-bis[(3,4-dihydroxyphenyl)methyl]-1-methylpyrrole-2,4-dicarboxamide (PubChem CID 67598436) has the molecular formula C21H21N3O6 and a molecular weight of 411.41 g/mol. Its IUPAC name is 2-N,4-N-bis[(3,4-dihydroxyphenyl)methyl]-1-methylpyrrole-2,4-dicarboxamide.
| Compound Name | 2-N,4-N-bis[(3,4-dihydroxyphenyl)methyl]-1-methylpyrrole-2,4-dicarboxamide |
|---|---|
| PubChem CID | 67598436 |
| Molecular Formula | C21H21N3O6 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 2-N,4-N-bis[(3,4-dihydroxyphenyl)methyl]-1-methylpyrrole-2,4-dicarboxamide |
| SMILES | Cn1cc(C(=O)NCc2ccc(O)c(O)c2)cc1C(=O)NCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C21H21N3O6/c1-24-11-14(20(29)22-9-12-2-4-16(25)18(27)6-12)8-15(24)21(30)23-10-13-3-5-17(26)19(28)7-13/h2-8,11,25-28H,9-10H2,1H3,(H,22,29)(H,23,30) |
| InChIKey | OPVYVTBOBADAKI-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 144.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|