C23H36O6 — CID 59913304
[(2S,3S,4E,6R)-4-(2-methoxy-2-oxoethylidene)-2-methyl-6-(2-methylbutyl)-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-3-yl] propanoate (PubChem CID 59913304) has the molecular formula C23H36O6 and a molecular weight of 408.54 g/mol. Its IUPAC name is [(2S,3S,4E,6R)-4-(2-methoxy-2-oxoethylidene)-2-methyl-6-(2-methylbutyl)-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-3-yl] propanoate.
| Compound Name | [(2S,3S,4E,6R)-4-(2-methoxy-2-oxoethylidene)-2-methyl-6-(2-methylbutyl)-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-3-yl] propanoate |
|---|---|
| PubChem CID | 59913304 |
| Molecular Formula | C23H36O6 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | [(2S,3S,4E,6R)-4-(2-methoxy-2-oxoethylidene)-2-methyl-6-(2-methylbutyl)-2-[(E)-2-methyl-5-oxopent-3-en-2-yl]oxan-3-yl] propanoate |
| SMILES | CCC(=O)O[C@H]1/C(=C/C(=O)OC)C[C@@H](CC(C)CC)O[C@@]1(C)C(C)(C)/C=C/C=O |
| InChI | InChI=1S/C23H36O6/c1-8-16(3)13-18-14-17(15-20(26)27-7)21(28-19(25)9-2)23(6,29-18)22(4,5)11-10-12-24/h10-12,15-16,18,21H,8-9,13-14H2,1-7H3/b11-10+,17-15+/t16?,18-,21+,23-/m1/s1 |
| InChIKey | CRLLEIDSPJMYIN-DLLHXJCCSA-N |
| XLogP | 4.17 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|