C26H34O8 — CID 101131121
[(1R,7S,8Z,11R,12R,13R,14S)-11,12-diacetyloxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-3,8,16-trien-14-yl] acetate (PubChem CID 101131121) has the molecular formula C26H34O8 and a molecular weight of 474.55 g/mol. Its IUPAC name is [(1R,7S,8Z,11R,12R,13R,14S)-11,12-diacetyloxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-3,8,16-trien-14-yl] acetate.
| Compound Name | [(1R,7S,8Z,11R,12R,13R,14S)-11,12-diacetyloxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-3,8,16-trien-14-yl] acetate |
|---|---|
| PubChem CID | 101131121 |
| Molecular Formula | C26H34O8 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | [(1R,7S,8Z,11R,12R,13R,14S)-11,12-diacetyloxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-3,8,16-trien-14-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC=C(C)[C@H]2CC3=C(C)C(=O)O[C@H]3/C=C(/C)C[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@]12C |
| InChI | InChI=1S/C26H34O8/c1-13-10-21-19(15(3)25(30)34-21)12-20-14(2)8-9-23(32-17(5)28)26(20,7)24(33-18(6)29)22(11-13)31-16(4)27/h8,10,20-24H,9,11-12H2,1-7H3/b13-10-/t20-,21+,22-,23+,24+,26-/m1/s1 |
| InChIKey | UVULRSYDTPPXKK-BHBKELKXSA-N |
| XLogP | 3.74 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|