C2H4NO2- — CID 59915671
2-amino-2,2-dideuterioacetate (PubChem CID 59915671) has the molecular formula C2H4NO2- and a molecular weight of 76.07 g/mol. Its IUPAC name is 2-amino-2,2-dideuterioacetate.
| Compound Name | 2-amino-2,2-dideuterioacetate |
|---|---|
| PubChem CID | 59915671 |
| Molecular Formula | C2H4NO2- |
| Molecular Weight | 76.07 g/mol |
| Exact Mass | 76.04 |
| IUPAC Name | 2-amino-2,2-dideuterioacetate |
| SMILES | [2H]C([2H])(N)C(=O)[O-] |
| InChI | InChI=1S/C2H5NO2/c3-1-2(4)5/h1,3H2,(H,4,5)/p-1/i1D2 |
| InChIKey | DHMQDGOQFOQNFH-DICFDUPASA-M |
| XLogP | -2.31 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 76.07 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |