C24H33FN2O — CID 59915868
N-[(3R)-1-[2-(4-fluorophenyl)ethyl]pyrrolidin-3-yl]-N-methyladamantane-1-carboxamide (PubChem CID 59915868) has the molecular formula C24H33FN2O and a molecular weight of 384.54 g/mol. Its IUPAC name is N-[(3R)-1-[2-(4-fluorophenyl)ethyl]pyrrolidin-3-yl]-N-methyladamantane-1-carboxamide.
| Compound Name | N-[(3R)-1-[2-(4-fluorophenyl)ethyl]pyrrolidin-3-yl]-N-methyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 59915868 |
| Molecular Formula | C24H33FN2O |
| Molecular Weight | 384.54 g/mol |
| Exact Mass | 384.26 |
| IUPAC Name | N-[(3R)-1-[2-(4-fluorophenyl)ethyl]pyrrolidin-3-yl]-N-methyladamantane-1-carboxamide |
| SMILES | CN(C(=O)C12CC3CC(CC(C3)C1)C2)[C@@H]1CCN(CCc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C24H33FN2O/c1-26(23(28)24-13-18-10-19(14-24)12-20(11-18)15-24)22-7-9-27(16-22)8-6-17-2-4-21(25)5-3-17/h2-5,18-20,22H,6-16H2,1H3/t18?,19?,20?,22-,24?/m1/s1 |
| InChIKey | CKCGHSPFDYQUIS-GPUVRGFBSA-N |
| XLogP | 4.12 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.54 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |