C22H31FN2O2S — CID 18411818
N-[1-[2-(4-fluorophenyl)ethyl]pyrrolidin-3-yl]adamantane-1-sulfonamide (PubChem CID 18411818) has the molecular formula C22H31FN2O2S and a molecular weight of 406.57 g/mol. Its IUPAC name is N-[1-[2-(4-fluorophenyl)ethyl]pyrrolidin-3-yl]adamantane-1-sulfonamide.
| Compound Name | N-[1-[2-(4-fluorophenyl)ethyl]pyrrolidin-3-yl]adamantane-1-sulfonamide |
|---|---|
| PubChem CID | 18411818 |
| Molecular Formula | C22H31FN2O2S |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | N-[1-[2-(4-fluorophenyl)ethyl]pyrrolidin-3-yl]adamantane-1-sulfonamide |
| SMILES | O=S(=O)(NC1CCN(CCc2ccc(F)cc2)C1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H31FN2O2S/c23-20-3-1-16(2-4-20)5-7-25-8-6-21(15-25)24-28(26,27)22-12-17-9-18(13-22)11-19(10-17)14-22/h1-4,17-19,21,24H,5-15H2 |
| InChIKey | RJJOTIYVTVNRNL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |