C22H35FN2O2 — CID 97308630
tert-butyl (2S)-2-[[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]amino]pentanoate (PubChem CID 97308630) has the molecular formula C22H35FN2O2 and a molecular weight of 378.53 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]amino]pentanoate.
| Compound Name | tert-butyl (2S)-2-[[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]amino]pentanoate |
|---|---|
| PubChem CID | 97308630 |
| Molecular Formula | C22H35FN2O2 |
| Molecular Weight | 378.53 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | tert-butyl (2S)-2-[[1-[2-(4-fluorophenyl)ethyl]piperidin-4-yl]amino]pentanoate |
| SMILES | CCC[C@H](NC1CCN(CCc2ccc(F)cc2)CC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H35FN2O2/c1-5-6-20(21(26)27-22(2,3)4)24-19-12-15-25(16-13-19)14-11-17-7-9-18(23)10-8-17/h7-10,19-20,24H,5-6,11-16H2,1-4H3/t20-/m0/s1 |
| InChIKey | FQRSOSOFIZWFIK-FQEVSTJZSA-N |
| XLogP | 3.93 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.53 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |