C18H34N2O4 — CID 75458656
tert-butyl 2-[[1-(2-methoxy-2-oxoethyl)piperidin-4-yl]amino]hexanoate (PubChem CID 75458656) has the molecular formula C18H34N2O4 and a molecular weight of 342.48 g/mol. Its IUPAC name is tert-butyl 2-[[1-(2-methoxy-2-oxoethyl)piperidin-4-yl]amino]hexanoate.
| Compound Name | tert-butyl 2-[[1-(2-methoxy-2-oxoethyl)piperidin-4-yl]amino]hexanoate |
|---|---|
| PubChem CID | 75458656 |
| Molecular Formula | C18H34N2O4 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.25 |
| IUPAC Name | tert-butyl 2-[[1-(2-methoxy-2-oxoethyl)piperidin-4-yl]amino]hexanoate |
| SMILES | CCCCC(NC1CCN(CC(=O)OC)CC1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H34N2O4/c1-6-7-8-15(17(22)24-18(2,3)4)19-14-9-11-20(12-10-14)13-16(21)23-5/h14-15,19H,6-13H2,1-5H3 |
| InChIKey | VPDIUXNYKNVAPJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |