C24H31F3N2O — CID 22888129
N-[1-[2-[4-(trifluoromethyl)phenyl]ethyl]pyrrolidin-3-yl]adamantane-1-carboxamide (PubChem CID 22888129) has the molecular formula C24H31F3N2O and a molecular weight of 420.52 g/mol. Its IUPAC name is N-[1-[2-[4-(trifluoromethyl)phenyl]ethyl]pyrrolidin-3-yl]adamantane-1-carboxamide.
| Compound Name | N-[1-[2-[4-(trifluoromethyl)phenyl]ethyl]pyrrolidin-3-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 22888129 |
| Molecular Formula | C24H31F3N2O |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | N-[1-[2-[4-(trifluoromethyl)phenyl]ethyl]pyrrolidin-3-yl]adamantane-1-carboxamide |
| SMILES | O=C(NC1CCN(CCc2ccc(C(F)(F)F)cc2)C1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H31F3N2O/c25-24(26,27)20-3-1-16(2-4-20)5-7-29-8-6-21(15-29)28-22(30)23-12-17-9-18(13-23)11-19(10-17)14-23/h1-4,17-19,21H,5-15H2,(H,28,30) |
| InChIKey | HHMKDUSRGJSDGA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |