C22H23F4NO — CID 10023485
1-(4-fluorophenyl)-2-[1-[2-[4-(trifluoromethyl)phenyl]ethyl]piperidin-4-yl]ethanone (PubChem CID 10023485) has the molecular formula C22H23F4NO and a molecular weight of 393.42 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2-[1-[2-[4-(trifluoromethyl)phenyl]ethyl]piperidin-4-yl]ethanone.
| Compound Name | 1-(4-fluorophenyl)-2-[1-[2-[4-(trifluoromethyl)phenyl]ethyl]piperidin-4-yl]ethanone |
|---|---|
| PubChem CID | 10023485 |
| Molecular Formula | C22H23F4NO |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 1-(4-fluorophenyl)-2-[1-[2-[4-(trifluoromethyl)phenyl]ethyl]piperidin-4-yl]ethanone |
| SMILES | O=C(CC1CCN(CCc2ccc(C(F)(F)F)cc2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H23F4NO/c23-20-7-3-18(4-8-20)21(28)15-17-10-13-27(14-11-17)12-9-16-1-5-19(6-2-16)22(24,25)26/h1-8,17H,9-15H2 |
| InChIKey | JXDNMESNLICMIF-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |