C22H24Cl2FNO2 — CID 142055463
2-[1-[3-(3,4-dichlorophenoxy)propyl]piperidin-4-yl]-1-(4-fluorophenyl)ethanone (PubChem CID 142055463) has the molecular formula C22H24Cl2FNO2 and a molecular weight of 424.34 g/mol. Its IUPAC name is 2-[1-[3-(3,4-dichlorophenoxy)propyl]piperidin-4-yl]-1-(4-fluorophenyl)ethanone.
| Compound Name | 2-[1-[3-(3,4-dichlorophenoxy)propyl]piperidin-4-yl]-1-(4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 142055463 |
| Molecular Formula | C22H24Cl2FNO2 |
| Molecular Weight | 424.34 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 2-[1-[3-(3,4-dichlorophenoxy)propyl]piperidin-4-yl]-1-(4-fluorophenyl)ethanone |
| SMILES | O=C(CC1CCN(CCCOc2ccc(Cl)c(Cl)c2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H24Cl2FNO2/c23-20-7-6-19(15-21(20)24)28-13-1-10-26-11-8-16(9-12-26)14-22(27)17-2-4-18(25)5-3-17/h2-7,15-16H,1,8-14H2 |
| InChIKey | KCFCVSRALHGRID-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.34 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|