C17H19NO4 — CID 59917968
methyl (2Z)-2-(5,6-dimethoxy-3,3-dimethyl-2H-inden-1-ylidene)-2-isocyanoacetate (PubChem CID 59917968) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is methyl (2Z)-2-(5,6-dimethoxy-3,3-dimethyl-2H-inden-1-ylidene)-2-isocyanoacetate.
| Compound Name | methyl (2Z)-2-(5,6-dimethoxy-3,3-dimethyl-2H-inden-1-ylidene)-2-isocyanoacetate |
|---|---|
| PubChem CID | 59917968 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | methyl (2Z)-2-(5,6-dimethoxy-3,3-dimethyl-2H-inden-1-ylidene)-2-isocyanoacetate |
| SMILES | [C-]#[N+]/C(C(=O)OC)=C1/CC(C)(C)c2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C17H19NO4/c1-17(2)9-11(15(18-3)16(19)22-6)10-7-13(20-4)14(21-5)8-12(10)17/h7-8H,9H2,1-2,4-6H3/b15-11- |
| InChIKey | YTVKFYJGPJRMNU-PTNGSMBKSA-N |
| XLogP | 3.19 |
| TPSA | 49.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|