C19H20N2O3 — CID 59899639
(2E)-2-cyano-2-(5,6-dimethoxy-3,3-dimethyl-2H-inden-1-ylidene)-N-prop-2-ynylacetamide (PubChem CID 59899639) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is (2E)-2-cyano-2-(5,6-dimethoxy-3,3-dimethyl-2H-inden-1-ylidene)-N-prop-2-ynylacetamide.
| Compound Name | (2E)-2-cyano-2-(5,6-dimethoxy-3,3-dimethyl-2H-inden-1-ylidene)-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 59899639 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | (2E)-2-cyano-2-(5,6-dimethoxy-3,3-dimethyl-2H-inden-1-ylidene)-N-prop-2-ynylacetamide |
| SMILES | C#CCNC(=O)/C(C#N)=C1\CC(C)(C)c2cc(OC)c(OC)cc21 |
| InChI | InChI=1S/C19H20N2O3/c1-6-7-21-18(22)14(11-20)13-10-19(2,3)15-9-17(24-5)16(23-4)8-12(13)15/h1,8-9H,7,10H2,2-5H3,(H,21,22)/b14-13+ |
| InChIKey | DJHNWGZFHKOLSL-BUHFOSPRSA-N |
| XLogP | 2.41 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|