C39H53N3O6 — CID 20592583
(E)-3-(5,6-dimethoxy-3,3-dimethyl-1,2-dihydroinden-2-yl)-N-[3-[3-[[(E)-3-(5,6-dimethoxy-1,1-dimethylinden-2-yl)prop-2-enoyl]amino]propyl-methylamino]propyl]prop-2-enamide (PubChem CID 20592583) has the molecular formula C39H53N3O6 and a molecular weight of 659.87 g/mol. Its IUPAC name is (E)-3-(5,6-dimethoxy-3,3-dimethyl-1,2-dihydroinden-2-yl)-N-[3-[3-[[(E)-3-(5,6-dimethoxy-1,1-dimethylinden-2-yl)prop-2-enoyl]amino]propyl-methylamino]propyl]prop-2-enamide.
| Compound Name | (E)-3-(5,6-dimethoxy-3,3-dimethyl-1,2-dihydroinden-2-yl)-N-[3-[3-[[(E)-3-(5,6-dimethoxy-1,1-dimethylinden-2-yl)prop-2-enoyl]amino]propyl-methylamino]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 20592583 |
| Molecular Formula | C39H53N3O6 |
| Molecular Weight | 659.87 g/mol |
| Exact Mass | 659.39 |
| IUPAC Name | (E)-3-(5,6-dimethoxy-3,3-dimethyl-1,2-dihydroinden-2-yl)-N-[3-[3-[[(E)-3-(5,6-dimethoxy-1,1-dimethylinden-2-yl)prop-2-enoyl]amino]propyl-methylamino]propyl]prop-2-enamide |
| SMILES | COc1cc2c(cc1OC)C(C)(C)C(/C=C/C(=O)NCCCN(C)CCCNC(=O)/C=C/C1Cc3cc(OC)c(OC)cc3C1(C)C)=C2 |
| InChI | InChI=1S/C39H53N3O6/c1-38(2)28(20-26-22-32(45-6)34(47-8)24-30(26)38)12-14-36(43)40-16-10-18-42(5)19-11-17-41-37(44)15-13-29-21-27-23-33(46-7)35(48-9)25-31(27)39(29,3)4/h12-15,20,22-25,29H,10-11,16-19,21H2,1-9H3,(H,40,43)(H,41,44)/b14-12+,15-13+ |
| InChIKey | QPUBVBHJVYCBHZ-QUMQEAAQSA-N |
| XLogP | 5.60 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.87 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|