C23H26ClIN2O2 — CID 59919683
2-(4-amino-3-iodophenyl)ethyl (3S,5R)-3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 59919683) has the molecular formula C23H26ClIN2O2 and a molecular weight of 524.83 g/mol. Its IUPAC name is 2-(4-amino-3-iodophenyl)ethyl (3S,5R)-3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | 2-(4-amino-3-iodophenyl)ethyl (3S,5R)-3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 59919683 |
| Molecular Formula | C23H26ClIN2O2 |
| Molecular Weight | 524.83 g/mol |
| Exact Mass | 524.07 |
| IUPAC Name | 2-(4-amino-3-iodophenyl)ethyl (3S,5R)-3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | CN1C2CC[C@@H]1C[C@H](c1ccc(Cl)cc1)C2C(=O)OCCc1ccc(N)c(I)c1 |
| InChI | InChI=1S/C23H26ClIN2O2/c1-27-17-7-9-21(27)22(18(13-17)15-3-5-16(24)6-4-15)23(28)29-11-10-14-2-8-20(26)19(25)12-14/h2-6,8,12,17-18,21-22H,7,9-11,13,26H2,1H3/t17-,18-,21?,22?/m1/s1 |
| InChIKey | QFSPRCFKRIHDRH-NFAVZRQZSA-N |
| XLogP | 4.88 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.83 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|