C15H16NO2Y- — CID 59920112
methyl 2,6-dimethyl-4-phenyl-3,4-dihydro-1H-pyridin-3-ide-5-carboxylate;yttrium (PubChem CID 59920112) has the molecular formula C15H16NO2Y- and a molecular weight of 331.20 g/mol. Its IUPAC name is methyl 2,6-dimethyl-4-phenyl-3,4-dihydro-1H-pyridin-3-ide-5-carboxylate;yttrium.
| Compound Name | methyl 2,6-dimethyl-4-phenyl-3,4-dihydro-1H-pyridin-3-ide-5-carboxylate;yttrium |
|---|---|
| PubChem CID | 59920112 |
| Molecular Formula | C15H16NO2Y- |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | methyl 2,6-dimethyl-4-phenyl-3,4-dihydro-1H-pyridin-3-ide-5-carboxylate;yttrium |
| SMILES | COC(=O)C1=C(C)NC(C)=[C-]C1c1ccccc1.[Y] |
| InChI | InChI=1S/C15H16NO2.Y/c1-10-9-13(12-7-5-4-6-8-12)14(11(2)16-10)15(17)18-3;/h4-8,13,16H,1-3H3;/q-1; |
| InChIKey | USZRJUMOMVXUCE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|