C19H26N2O7P2 — CID 59922048
prop-2-enyl (2S)-3-[4-[[2-(diphosphanyloxy)-2-oxoacetyl]amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 59922048) has the molecular formula C19H26N2O7P2 and a molecular weight of 456.37 g/mol. Its IUPAC name is prop-2-enyl (2S)-3-[4-[[2-(diphosphanyloxy)-2-oxoacetyl]amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | prop-2-enyl (2S)-3-[4-[[2-(diphosphanyloxy)-2-oxoacetyl]amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 59922048 |
| Molecular Formula | C19H26N2O7P2 |
| Molecular Weight | 456.37 g/mol |
| Exact Mass | 456.12 |
| IUPAC Name | prop-2-enyl (2S)-3-[4-[[2-(diphosphanyloxy)-2-oxoacetyl]amino]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | C=CCOC(=O)[C@H](Cc1ccc(NC(=O)C(=O)OPP)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H26N2O7P2/c1-5-10-26-16(23)14(21-18(25)27-19(2,3)4)11-12-6-8-13(9-7-12)20-15(22)17(24)28-30-29/h5-9,14,30H,1,10-11,29H2,2-4H3,(H,20,22)(H,21,25)/t14-/m0/s1 |
| InChIKey | JFGVRZXBTSQMKM-AWEZNQCLSA-N |
| XLogP | 2.72 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|