C19H37N3O6 — CID 59923443
(2S)-2-[[2-hydroxyethyl(3-methylbutyl)carbamoyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (PubChem CID 59923443) has the molecular formula C19H37N3O6 and a molecular weight of 403.52 g/mol. Its IUPAC name is (2S)-2-[[2-hydroxyethyl(3-methylbutyl)carbamoyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid.
| Compound Name | (2S)-2-[[2-hydroxyethyl(3-methylbutyl)carbamoyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 59923443 |
| Molecular Formula | C19H37N3O6 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.27 |
| IUPAC Name | (2S)-2-[[2-hydroxyethyl(3-methylbutyl)carbamoyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| SMILES | CC(C)CCN(CCO)C(=O)N[C@@H](CCCCNC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C19H37N3O6/c1-14(2)9-11-22(12-13-23)17(26)21-15(16(24)25)8-6-7-10-20-18(27)28-19(3,4)5/h14-15,23H,6-13H2,1-5H3,(H,20,27)(H,21,26)(H,24,25)/t15-/m0/s1 |
| InChIKey | BOPYAAIRJCRAGK-HNNXBMFYSA-N |
| XLogP | 2.18 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|