C22H35N3O6 — CID 142647652
(2S)-2-[[2-hydroxyethyl(3-methylbutyl)carbamoyl]amino]-7-oxo-7-(phenylmethoxyamino)heptanoic acid (PubChem CID 142647652) has the molecular formula C22H35N3O6 and a molecular weight of 437.54 g/mol. Its IUPAC name is (2S)-2-[[2-hydroxyethyl(3-methylbutyl)carbamoyl]amino]-7-oxo-7-(phenylmethoxyamino)heptanoic acid.
| Compound Name | (2S)-2-[[2-hydroxyethyl(3-methylbutyl)carbamoyl]amino]-7-oxo-7-(phenylmethoxyamino)heptanoic acid |
|---|---|
| PubChem CID | 142647652 |
| Molecular Formula | C22H35N3O6 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | (2S)-2-[[2-hydroxyethyl(3-methylbutyl)carbamoyl]amino]-7-oxo-7-(phenylmethoxyamino)heptanoic acid |
| SMILES | CC(C)CCN(CCO)C(=O)N[C@@H](CCCCC(=O)NOCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C22H35N3O6/c1-17(2)12-13-25(14-15-26)22(30)23-19(21(28)29)10-6-7-11-20(27)24-31-16-18-8-4-3-5-9-18/h3-5,8-9,17,19,26H,6-7,10-16H2,1-2H3,(H,23,30)(H,24,27)(H,28,29)/t19-/m0/s1 |
| InChIKey | UBOLWARWEPQURV-IBGZPJMESA-N |
| XLogP | 2.30 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|