C21H36O — CID 59924050
1-(4-ethyl-4-methylcyclohexyl)-3-(1,4,4-trimethylcyclohexyl)prop-2-en-1-one (PubChem CID 59924050) has the molecular formula C21H36O and a molecular weight of 304.52 g/mol. Its IUPAC name is 1-(4-ethyl-4-methylcyclohexyl)-3-(1,4,4-trimethylcyclohexyl)prop-2-en-1-one.
| Compound Name | 1-(4-ethyl-4-methylcyclohexyl)-3-(1,4,4-trimethylcyclohexyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 59924050 |
| Molecular Formula | C21H36O |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.28 |
| IUPAC Name | 1-(4-ethyl-4-methylcyclohexyl)-3-(1,4,4-trimethylcyclohexyl)prop-2-en-1-one |
| SMILES | CCC1(C)CCC(C(=O)C=CC2(C)CCC(C)(C)CC2)CC1 |
| InChI | InChI=1S/C21H36O/c1-6-20(4)10-7-17(8-11-20)18(22)9-12-21(5)15-13-19(2,3)14-16-21/h9,12,17H,6-8,10-11,13-16H2,1-5H3 |
| InChIKey | LCMMQSGNESVPMW-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|