C19H33NO5 — CID 59924288
tert-butyl (2R)-2-[(5S)-6-methoxy-5-methyl-6-oxohexyl]-7-oxoazepane-1-carboxylate (PubChem CID 59924288) has the molecular formula C19H33NO5 and a molecular weight of 355.48 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(5S)-6-methoxy-5-methyl-6-oxohexyl]-7-oxoazepane-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-[(5S)-6-methoxy-5-methyl-6-oxohexyl]-7-oxoazepane-1-carboxylate |
|---|---|
| PubChem CID | 59924288 |
| Molecular Formula | C19H33NO5 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | tert-butyl (2R)-2-[(5S)-6-methoxy-5-methyl-6-oxohexyl]-7-oxoazepane-1-carboxylate |
| SMILES | COC(=O)[C@@H](C)CCCC[C@@H]1CCCCC(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H33NO5/c1-14(17(22)24-5)10-6-7-11-15-12-8-9-13-16(21)20(15)18(23)25-19(2,3)4/h14-15H,6-13H2,1-5H3/t14-,15+/m0/s1 |
| InChIKey | VILIPKCMCORMBV-LSDHHAIUSA-N |
| XLogP | 4.06 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|