C6H15O3P — CID 59925693
2-(2-deuteriooxyethoxy)ethoxy-dimethylphosphane (PubChem CID 59925693) has the molecular formula C6H15O3P and a molecular weight of 167.16 g/mol. Its IUPAC name is 2-(2-deuteriooxyethoxy)ethoxy-dimethylphosphane.
| Compound Name | 2-(2-deuteriooxyethoxy)ethoxy-dimethylphosphane |
|---|---|
| PubChem CID | 59925693 |
| Molecular Formula | C6H15O3P |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | 2-(2-deuteriooxyethoxy)ethoxy-dimethylphosphane |
| SMILES | [2H]OCCOCCOP(C)C |
| InChI | InChI=1S/C6H15O3P/c1-10(2)9-6-5-8-4-3-7/h7H,3-6H2,1-2H3/i7D |
| InChIKey | ILNBGSKFHGSXSG-WHRKIXHSSA-N |
| XLogP | 0.67 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|