C19H41N2O7P — CID 171599714
[2-[2-[2-[2-(2-deuteriooxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy-[di(propan-2-yl)amino]phosphanyl] N-ethylmethanimidate (PubChem CID 171599714) has the molecular formula C19H41N2O7P and a molecular weight of 441.52 g/mol. Its IUPAC name is [2-[2-[2-[2-(2-deuteriooxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy-[di(propan-2-yl)amino]phosphanyl] N-ethylmethanimidate.
| Compound Name | [2-[2-[2-[2-(2-deuteriooxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy-[di(propan-2-yl)amino]phosphanyl] N-ethylmethanimidate |
|---|---|
| PubChem CID | 171599714 |
| Molecular Formula | C19H41N2O7P |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | [2-[2-[2-[2-(2-deuteriooxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy-[di(propan-2-yl)amino]phosphanyl] N-ethylmethanimidate |
| SMILES | [2H]OCCOCCOCCOCCOCCOP(O/C=N/CC)N(C(C)C)C(C)C |
| InChI | InChI=1S/C19H41N2O7P/c1-6-20-17-28-29(21(18(2)3)19(4)5)27-16-15-26-14-13-25-12-11-24-10-9-23-8-7-22/h17-19,22H,6-16H2,1-5H3/b20-17+/i22D |
| InChIKey | IELRPGPDAAWDBG-SAJMQSFNSA-N |
| XLogP | 2.47 |
| TPSA | 91.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|