About [[di(propan-2-yl)amino]-[2-(2-ethoxyethoxy)ethoxy]phosphanyl] N-ethylmethanimidate
[[di(propan-2-yl)amino]-[2-(2-ethoxyethoxy)ethoxy]phosphanyl] N-ethylmethanimidate (PubChem CID 170258789) has the molecular formula C15H33N2O4P
and a molecular weight of 336.41 g/mol. Its IUPAC name is [[di(propan-2-yl)amino]-[2-(2-ethoxyethoxy)ethoxy]phosphanyl] N-ethylmethanimidate.
Molecular Properties
| Compound Name | [[di(propan-2-yl)amino]-[2-(2-ethoxyethoxy)ethoxy]phosphanyl] N-ethylmethanimidate |
| PubChem CID | 170258789 |
| Molecular Formula | C15H33N2O4P |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | [[di(propan-2-yl)amino]-[2-(2-ethoxyethoxy)ethoxy]phosphanyl] N-ethylmethanimidate |
| SMILES | CC/N=C/OP(OCCOCCOCC)N(C(C)C)C(C)C |
| InChI | InChI=1S/C15H33N2O4P/c1-7-16-13-21-22(17(14(3)4)15(5)6)20-12-11-19-10-9-18-8-2/h13-15H,7-12H2,1-6H3/b16-13+ |
| InChIKey | SFAFAWVIRNJGNG-DTQAZKPQSA-N |
| XLogP | 3.47 |
| TPSA | 52.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [[di(propan-2-yl)amino]-[2-(2-ethoxyethoxy)ethoxy]phosphanyl] N-ethylmethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[di(propan-2-yl)amino]-[2-(2-ethoxyethoxy)ethoxy]phosphanyl] N-ethylmethanimidate?
The IUPAC name of [[di(propan-2-yl)amino]-[2-(2-ethoxyethoxy)ethoxy]phosphanyl] N-ethylmethanimidate (CID 170258789) is [[di(propan-2-yl)amino]-[2-(2-ethoxyethoxy)ethoxy]phosphanyl] N-ethylmethanimidate.
What is the SMILES notation for [[di(propan-2-yl)amino]-[2-(2-ethoxyethoxy)ethoxy]phosphanyl] N-ethylmethanimidate?
The canonical SMILES for [[di(propan-2-yl)amino]-[2-(2-ethoxyethoxy)ethoxy]phosphanyl] N-ethylmethanimidate is CC/N=C/OP(OCCOCCOCC)N(C(C)C)C(C)C.
What is the InChIKey of [[di(propan-2-yl)amino]-[2-(2-ethoxyethoxy)ethoxy]phosphanyl] N-ethylmethanimidate?
The InChIKey is SFAFAWVIRNJGNG-DTQAZKPQSA-N. The full InChI is InChI=1S/C15H33N2O4P/c1-7-16-13-21-22(17(14(3)4)15(5)6)20-12-11-19-10-9-18-8-2/h13-15H,7-12H2,1-6H3/b16-13+.
What are the key properties of [[di(propan-2-yl)amino]-[2-(2-ethoxyethoxy)ethoxy]phosphanyl] N-ethylmethanimidate?
[[di(propan-2-yl)amino]-[2-(2-ethoxyethoxy)ethoxy]phosphanyl] N-ethylmethanimidate has a molecular weight of 336.41 g/mol, XLogP of 3.47, 14 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [[di(propan-2-yl)amino]-[2-(2-ethoxyethoxy)ethoxy]phosphanyl] N-ethylmethanimidate is sourced from PubChem (CID 170258789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).