C10H21N2O3P — CID 118027067
3-[3-deuteriooxypropoxy-[methyl(propan-2-yl)amino]phosphanyl]oxypropanenitrile (PubChem CID 118027067) has the molecular formula C10H21N2O3P and a molecular weight of 249.27 g/mol. Its IUPAC name is 3-[3-deuteriooxypropoxy-[methyl(propan-2-yl)amino]phosphanyl]oxypropanenitrile.
| Compound Name | 3-[3-deuteriooxypropoxy-[methyl(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
|---|---|
| PubChem CID | 118027067 |
| Molecular Formula | C10H21N2O3P |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 3-[3-deuteriooxypropoxy-[methyl(propan-2-yl)amino]phosphanyl]oxypropanenitrile |
| SMILES | [2H]OCCCOP(OCCC#N)N(C)C(C)C |
| InChI | InChI=1S/C10H21N2O3P/c1-10(2)12(3)16(14-8-4-6-11)15-9-5-7-13/h10,13H,4-5,7-9H2,1-3H3/i13D |
| InChIKey | GPSPMPMYZLBJRP-YSOHJTORSA-N |
| XLogP | 1.88 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|