C6H10BN3OS — CID 59926900
CID 59926900 (PubChem CID 59926900) has the molecular formula C6H10BN3OS and a molecular weight of 183.05 g/mol.
| Compound Name | CID 59926900 |
|---|---|
| PubChem CID | 59926900 |
| Molecular Formula | C6H10BN3OS |
| Molecular Weight | 183.05 g/mol |
| Exact Mass | 183.06 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N[C@@H]1C[C@@H](CN)NC1=S |
| InChI | InChI=1S/C6H10BN3OS/c7-6(11)10-4-1-3(2-8)9-5(4)12/h3-4H,1-2,8H2,(H,9,12)(H,10,11)/t3-,4+/m0/s1 |
| InChIKey | GVLOJGJYELJFQL-IUYQGCFVSA-N |
| XLogP | -1.12 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.05 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|