C6H7BN2O3 — CID 59926489
CID 59926489 (PubChem CID 59926489) has the molecular formula C6H7BN2O3 and a molecular weight of 165.94 g/mol.
| Compound Name | CID 59926489 |
|---|---|
| PubChem CID | 59926489 |
| Molecular Formula | C6H7BN2O3 |
| Molecular Weight | 165.94 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | — |
| SMILES | [B]C(=O)N[C@@H]1C[C@H](C=O)NC1=O |
| InChI | InChI=1S/C6H7BN2O3/c7-6(12)9-4-1-3(2-10)8-5(4)11/h2-4H,1H2,(H,8,11)(H,9,12)/t3-,4-/m1/s1 |
| InChIKey | NRWIZXGKJJXDGZ-QWWZWVQMSA-N |
| XLogP | -1.68 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.94 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|