C18H21N3O4 — CID 59928344
2-(dimethylamino)-5-[2-(1-methylindol-3-yl)propan-2-yl]-4-oxo-1,3-oxazole-5-carboxylic acid (PubChem CID 59928344) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is 2-(dimethylamino)-5-[2-(1-methylindol-3-yl)propan-2-yl]-4-oxo-1,3-oxazole-5-carboxylic acid.
| Compound Name | 2-(dimethylamino)-5-[2-(1-methylindol-3-yl)propan-2-yl]-4-oxo-1,3-oxazole-5-carboxylic acid |
|---|---|
| PubChem CID | 59928344 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 2-(dimethylamino)-5-[2-(1-methylindol-3-yl)propan-2-yl]-4-oxo-1,3-oxazole-5-carboxylic acid |
| SMILES | CN(C)C1=NC(=O)C(C(=O)O)(C(C)(C)c2cn(C)c3ccccc23)O1 |
| InChI | InChI=1S/C18H21N3O4/c1-17(2,12-10-21(5)13-9-7-6-8-11(12)13)18(15(23)24)14(22)19-16(25-18)20(3)4/h6-10H,1-5H3,(H,23,24) |
| InChIKey | MSVWJYWQMNGEJO-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 84.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|