C27H27NO3 — CID 59928499
6-[3-(dibenzylamino)phenyl]-6-ethyloxane-2,4-dione (PubChem CID 59928499) has the molecular formula C27H27NO3 and a molecular weight of 413.52 g/mol. Its IUPAC name is 6-[3-(dibenzylamino)phenyl]-6-ethyloxane-2,4-dione.
| Compound Name | 6-[3-(dibenzylamino)phenyl]-6-ethyloxane-2,4-dione |
|---|---|
| PubChem CID | 59928499 |
| Molecular Formula | C27H27NO3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 6-[3-(dibenzylamino)phenyl]-6-ethyloxane-2,4-dione |
| SMILES | CCC1(c2cccc(N(Cc3ccccc3)Cc3ccccc3)c2)CC(=O)CC(=O)O1 |
| InChI | InChI=1S/C27H27NO3/c1-2-27(18-25(29)17-26(30)31-27)23-14-9-15-24(16-23)28(19-21-10-5-3-6-11-21)20-22-12-7-4-8-13-22/h3-16H,2,17-20H2,1H3 |
| InChIKey | RCBWAPPNXUOAIE-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|