C17H28O6 — CID 59932826
pentyl 5-(2-methylprop-2-enoyloxy)-4-propanoyloxypentanoate (PubChem CID 59932826) has the molecular formula C17H28O6 and a molecular weight of 328.41 g/mol. Its IUPAC name is pentyl 5-(2-methylprop-2-enoyloxy)-4-propanoyloxypentanoate.
| Compound Name | pentyl 5-(2-methylprop-2-enoyloxy)-4-propanoyloxypentanoate |
|---|---|
| PubChem CID | 59932826 |
| Molecular Formula | C17H28O6 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | pentyl 5-(2-methylprop-2-enoyloxy)-4-propanoyloxypentanoate |
| SMILES | C=C(C)C(=O)OCC(CCC(=O)OCCCCC)OC(=O)CC |
| InChI | InChI=1S/C17H28O6/c1-5-7-8-11-21-16(19)10-9-14(23-15(18)6-2)12-22-17(20)13(3)4/h14H,3,5-12H2,1-2,4H3 |
| InChIKey | HYXGYMQXGQTGIB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|