About 1-bromo-4-[[4-(cyclohexylmethyl)cyclohexyl]methyl]-3-fluoro-5-methoxy-2,6-dimethylbenzene
1-bromo-4-[[4-(cyclohexylmethyl)cyclohexyl]methyl]-3-fluoro-5-methoxy-2,6-dimethylbenzene (PubChem CID 59933470) has the molecular formula C23H34BrFO
and a molecular weight of 425.43 g/mol. Its IUPAC name is 1-bromo-4-[[4-(cyclohexylmethyl)cyclohexyl]methyl]-3-fluoro-5-methoxy-2,6-dimethylbenzene.
Molecular Properties
| Compound Name | 1-bromo-4-[[4-(cyclohexylmethyl)cyclohexyl]methyl]-3-fluoro-5-methoxy-2,6-dimethylbenzene |
| PubChem CID | 59933470 |
| Molecular Formula | C23H34BrFO |
| Molecular Weight | 425.43 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 1-bromo-4-[[4-(cyclohexylmethyl)cyclohexyl]methyl]-3-fluoro-5-methoxy-2,6-dimethylbenzene |
| SMILES | COc1c(C)c(Br)c(C)c(F)c1CC1CCC(CC2CCCCC2)CC1 |
| InChI | InChI=1S/C23H34BrFO/c1-15-21(24)16(2)23(26-3)20(22(15)25)14-19-11-9-18(10-12-19)13-17-7-5-4-6-8-17/h17-19H,4-14H2,1-3H3 |
| InChIKey | AABOFBGKURMGJR-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.43 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-bromo-4-[[4-(cyclohexylmethyl)cyclohexyl]methyl]-3-fluoro-5-methoxy-2,6-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-[[4-(cyclohexylmethyl)cyclohexyl]methyl]-3-fluoro-5-methoxy-2,6-dimethylbenzene?
The IUPAC name of 1-bromo-4-[[4-(cyclohexylmethyl)cyclohexyl]methyl]-3-fluoro-5-methoxy-2,6-dimethylbenzene (CID 59933470) is 1-bromo-4-[[4-(cyclohexylmethyl)cyclohexyl]methyl]-3-fluoro-5-methoxy-2,6-dimethylbenzene.
What is the SMILES notation for 1-bromo-4-[[4-(cyclohexylmethyl)cyclohexyl]methyl]-3-fluoro-5-methoxy-2,6-dimethylbenzene?
The canonical SMILES for 1-bromo-4-[[4-(cyclohexylmethyl)cyclohexyl]methyl]-3-fluoro-5-methoxy-2,6-dimethylbenzene is COc1c(C)c(Br)c(C)c(F)c1CC1CCC(CC2CCCCC2)CC1.
What is the InChIKey of 1-bromo-4-[[4-(cyclohexylmethyl)cyclohexyl]methyl]-3-fluoro-5-methoxy-2,6-dimethylbenzene?
The InChIKey is AABOFBGKURMGJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H34BrFO/c1-15-21(24)16(2)23(26-3)20(22(15)25)14-19-11-9-18(10-12-19)13-17-7-5-4-6-8-17/h17-19H,4-14H2,1-3H3.
What are the key properties of 1-bromo-4-[[4-(cyclohexylmethyl)cyclohexyl]methyl]-3-fluoro-5-methoxy-2,6-dimethylbenzene?
1-bromo-4-[[4-(cyclohexylmethyl)cyclohexyl]methyl]-3-fluoro-5-methoxy-2,6-dimethylbenzene has a molecular weight of 425.43 g/mol, XLogP of 7.53, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-[[4-(cyclohexylmethyl)cyclohexyl]methyl]-3-fluoro-5-methoxy-2,6-dimethylbenzene is sourced from PubChem (CID 59933470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).