C18H27OY- — CID 59933483
1-(cyclohexylmethyl)-2-methoxy-3,4,5,6-tetramethylbenzene;yttrium (PubChem CID 59933483) has the molecular formula C18H27OY- and a molecular weight of 348.32 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-2-methoxy-3,4,5,6-tetramethylbenzene;yttrium.
| Compound Name | 1-(cyclohexylmethyl)-2-methoxy-3,4,5,6-tetramethylbenzene;yttrium |
|---|---|
| PubChem CID | 59933483 |
| Molecular Formula | C18H27OY- |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 1-(cyclohexylmethyl)-2-methoxy-3,4,5,6-tetramethylbenzene;yttrium |
| SMILES | COc1c(C)c(C)c(C)c(C)c1CC1CC[CH-]CC1.[Y] |
| InChI | InChI=1S/C18H27O.Y/c1-12-13(2)15(4)18(19-5)17(14(12)3)11-16-9-7-6-8-10-16;/h6,16H,7-11H2,1-5H3;/q-1; |
| InChIKey | DTDKIMZSDRPUKT-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|