C12H16N2O4 — CID 59938054
N-(acetamidomethyl)-3-(4-hydroxyphenoxy)propanamide (PubChem CID 59938054) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is N-(acetamidomethyl)-3-(4-hydroxyphenoxy)propanamide.
| Compound Name | N-(acetamidomethyl)-3-(4-hydroxyphenoxy)propanamide |
|---|---|
| PubChem CID | 59938054 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | N-(acetamidomethyl)-3-(4-hydroxyphenoxy)propanamide |
| SMILES | CC(=O)NCNC(=O)CCOc1ccc(O)cc1 |
| InChI | InChI=1S/C12H16N2O4/c1-9(15)13-8-14-12(17)6-7-18-11-4-2-10(16)3-5-11/h2-5,16H,6-8H2,1H3,(H,13,15)(H,14,17) |
| InChIKey | ZQQMSEPFEYOCTD-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|