C59H54N2O4 — CID 59940074
[4-[2-[4-[3-[3-(N-[4-[4-(N-[4-(2-methoxyethyl)phenyl]anilino)phenyl]phenyl]anilino)phenyl]propanoyl]phenyl]propan-2-yl]phenyl] acetate (PubChem CID 59940074) has the molecular formula C59H54N2O4 and a molecular weight of 855.09 g/mol. Its IUPAC name is [4-[2-[4-[3-[3-(N-[4-[4-(N-[4-(2-methoxyethyl)phenyl]anilino)phenyl]phenyl]anilino)phenyl]propanoyl]phenyl]propan-2-yl]phenyl] acetate.
| Compound Name | [4-[2-[4-[3-[3-(N-[4-[4-(N-[4-(2-methoxyethyl)phenyl]anilino)phenyl]phenyl]anilino)phenyl]propanoyl]phenyl]propan-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 59940074 |
| Molecular Formula | C59H54N2O4 |
| Molecular Weight | 855.09 g/mol |
| Exact Mass | 854.41 |
| IUPAC Name | [4-[2-[4-[3-[3-(N-[4-[4-(N-[4-(2-methoxyethyl)phenyl]anilino)phenyl]phenyl]anilino)phenyl]propanoyl]phenyl]propan-2-yl]phenyl] acetate |
| SMILES | COCCc1ccc(N(c2ccccc2)c2ccc(-c3ccc(N(c4ccccc4)c4cccc(CCC(=O)c5ccc(C(C)(C)c6ccc(OC(C)=O)cc6)cc5)c4)cc3)cc2)cc1 |
| InChI | InChI=1S/C59H54N2O4/c1-43(62)65-57-37-29-50(30-38-57)59(2,3)49-27-21-48(22-28-49)58(63)39-20-45-12-11-17-56(42-45)61(52-15-9-6-10-16-52)55-35-25-47(26-36-55)46-23-33-54(34-24-46)60(51-13-7-5-8-14-51)53-31-18-44(19-32-53)40-41-64-4/h5-19,21-38,42H,20,39-41H2,1-4H3 |
| InChIKey | RUONYKDAMAOKDI-UHFFFAOYSA-N |
| XLogP | 14.55 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.09 |
| LogP ≤ 5 | 14.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|